Index of /~pi/cpm/files/ftp.mayn.de/pub/cpm/archive/arc-lbr
NOTE: This list was created on Sun Oct 26 12:14:55 EST 1997
Some files may have been added or deleted since that date.
See file pub/cpm/filedocs/aaaread.me for additional information.
NOTE: Type B is Binary; Type A is ASCII
Directory pub/cpm/arc-lbr/
Filename Type Length Date Description
==============================================
ads.lbr B 11392 881216 Change date/time stamps of ARK files
ads2.lbr B 11392 890301 Change date/time stamps in ARKs
arc-file.izf B 4224 880303 Technical description of ARC format
ark11.ark B 13953 900216 Version 1.1 file ARKiver
ccpxtend.lbr B 30720 870214 Execute COM files from Libraries
cl10.lbr B 25344 910531 Compact library files similar to NULU -K
cpmshar.lbr B 32768 860720 CP/M version of Unix SHAR/UNSHAR
cpmunarj.zip B 18205 940330 Paul Hunt's CP/M Un-ARJ program
delbr11a.bug A 1121 870417 Bug report - DELBR program
delbr12.ark B 13184 891210 Extracts files from LBRs
dirarc2.pqs B 6784 860604 Display directory of MSDOS ARC's
exl.lbr B 7552 910604 View a file
exlpat.lbr B 2048 910611 Patch to exl to fix output file problem
extract.lbr B 6144 860522 Extracts files from LBRs
fastnulu.lbr B 14720 870523 Patched NULU comes up faster
lbrdsk23.lbr B 16384 850304 Treat libraries as a logical drive
lbrutil.lbr B 79232 861227 Date stamping for libraries (LBRs)
lchek.doc A 206 840130 Generate CHEK 1.5 compatible .lbr CRCs (DOC)
lchek11.com B 1920 850209 Generate CHEK 1.5 compatible .lbr CRCs (DOC)
lcrc.lbr B 4352 880124 Calculates and stores CRCs in LBRs
lcrck11.lbr B 8064 850617 Calculate .lbr file CRC
ldir-h1.lbr B 12416 880511 List the directory of a library
ldir2.lbr B 10240 850617 Quick LBR direcotry list
ldirb14.lbr B 26240 880902 Display LBR directory w/date/CRC/des
ldirb15.lbr B 24448 891212 Display LBR directory
lh-cpm11.lbr B 23552 890503 Uncompression utility for LHARC file
libutils.tzt B 1664 880130 Using NULU and LRUN with libraries
lrepair.lbr B 8960 910612 Repair .lbr file headers
lrun20.aqm B 14848 850209 Run .COM files inside LBRs
lrun20.com B 1536 850209 Run .COM files inside LBRs
lrun23.lbr B 17792 850717 Run .COM files inside LBRs
lsweep13.com B 16000 850209 Easy to use LBR file utility
lsweep13.dqc B 5632 850209 Easy to use LBR file utility (Doc)
lt31.lbr B 64768 921010 File type/extract/decompress
lu300.dqc B 20992 850209 Documentation for LU
lu300c.hqp B 10368 850209 LU library utility help
lu310.com B 20224 850209 Library Utility version 3.10
lu310.hlp A 580 850118 Help file for use with LU310
lu310.uqd B 2432 850209 Update info on LU310
ludef5.dqc B 10496 850209 Internal structure of LBR files
nlupatch.mzc B 1920 870228 Patches to NULU 1.51
nulu.pzt B 768 870510 Patch to speed up NULU start up
nulu01.iqf B 1152 850526 Information about NULU LBR utility
nulu10.hqp B 19200 850209 Help and usage description of NULU
nulu11.bq2 B 7808 851114 Description of a problem in NULU 1.1
nulu15.bqg B 2432 851114 Bug fix for NULU 1.5
nulu15.fix A 1385 860214 Bug fix for NULU 1.5
nulu15.not A 1280 860215 A note from the author of NULU151
nulu15.wq B 38912 860215 Complete user's guide for NULU151
nulu151.com B 15360 860215 Machine lang. Library Utility pgm
nulu152a.lbr B 56192 871216 Library maintenance utility
nuluterm.aqm B 2176 860215 Terminal configuration for NULU151
patchark.ark B 3261 880830 Kaypro RTC use for ARK035 or later
patvlu11.azm B 6272 880124 Use sweep-like utility with CP/M 2.2
pmautoae.com B 30976 940330 Self-extracting LZH and LHA archive utility
pull.lbr B 14592 861123 Extract one file from a library
setd01.lbr B 18944 871020 Set dates for members of libraries
setd22.lbr B 6016 880213 Set dates for members of libraries
sort.asm A 2117 840109 Shell-Metzner sort
sort.rel B 512 850209 Shell-Metzner sort (see sort.asm)
splay.arc B 3314 880902 SPLAY Trees data compression method
typel36.lbr B 19456 850209 Type ASCII files
typelz22.lbr B 38272 871031 Types ASCII
tzinst15.dzc B 1536 861228 Install instructions for TYPELZ v15+
unarc16.ark B 38656 870405 ARK/ARC file extraction utility
unarc16.com B 38656 940330 Self-extracting copy of UNARC version 1.6
unarc16.msg A 6192 870609 Extracting files from UNARK16.ARK
unarc16s.ark B 68096 870405 Source code of UNARC version 1.6
unarj101.lbr B 9472 940512 UNARJ 1.01 for CP/M
usqbase.mqc B 2816 850209 Handle unsqueezing files in programs
usqbase.rel B 1152 850209 Handle unsqueezing files in programs
![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}